About CID 73212630
CID 73212630 (PubChem CID 73212630) has the molecular formula C12H11N2O2
and a molecular weight of 215.23 g/mol.
Molecular Properties
| Compound Name | CID 73212630 |
| PubChem CID | 73212630 |
| Molecular Formula | C12H11N2O2 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | — |
| SMILES | O=c1ccn(C/C=C/[C]2[CH][CH][CH][CH]2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11N2O2/c15-11-7-9-14(12(16)13-11)8-3-6-10-4-1-2-5-10/h1-7,9H,8H2,(H,13,15,16)/b6-3+ |
| InChIKey | DJKZWVCGRAAJHA-ZZXKWVIFSA-N |
| XLogP | 0.50 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 73212630 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73212630?
The IUPAC name of CID 73212630 (CID 73212630) is not available.
What is the SMILES notation for CID 73212630?
The canonical SMILES for CID 73212630 is O=c1ccn(C/C=C/[C]2[CH][CH][CH][CH]2)c(=O)[nH]1.
What is the InChIKey of CID 73212630?
The InChIKey is DJKZWVCGRAAJHA-ZZXKWVIFSA-N. The full InChI is InChI=1S/C12H11N2O2/c15-11-7-9-14(12(16)13-11)8-3-6-10-4-1-2-5-10/h1-7,9H,8H2,(H,13,15,16)/b6-3+.
What are the key properties of CID 73212630?
CID 73212630 has a molecular weight of 215.23 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73212630 is sourced from PubChem (CID 73212630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).