About [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate
[(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate (PubChem CID 73212812) has the molecular formula C18H14O7
and a molecular weight of 342.30 g/mol. Its IUPAC name is [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate.
Molecular Properties
| Compound Name | [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate |
| PubChem CID | 73212812 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)cc2c1C(=O)/C(=C/c1ccc(O)c(O)c1)CO2 |
| InChI | InChI=1S/C18H14O7/c1-9(19)25-16-7-12(20)6-15-17(16)18(23)11(8-24-15)4-10-2-3-13(21)14(22)5-10/h2-7,20-22H,8H2,1H3/b11-4+ |
| InChIKey | DBQSMZBWTHHICO-NYYWCZLTSA-N |
| XLogP | 2.39 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate?
The IUPAC name of [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate (CID 73212812) is [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate.
What is the SMILES notation for [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate?
The canonical SMILES for [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate is CC(=O)Oc1cc(O)cc2c1C(=O)/C(=C/c1ccc(O)c(O)c1)CO2.
What is the InChIKey of [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate?
The InChIKey is DBQSMZBWTHHICO-NYYWCZLTSA-N. The full InChI is InChI=1S/C18H14O7/c1-9(19)25-16-7-12(20)6-15-17(16)18(23)11(8-24-15)4-10-2-3-13(21)14(22)5-10/h2-7,20-22H,8H2,1H3/b11-4+.
What are the key properties of [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate?
[(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate has a molecular weight of 342.30 g/mol, XLogP of 2.39, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-3-[(3,4-dihydroxyphenyl)methylidene]-7-hydroxy-4-oxochromen-5-yl] acetate is sourced from PubChem (CID 73212812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).