C17H18BrFN2O — CID 73212848
4-bromo-N-(cyclobutylmethyl)-N-[(3-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide (PubChem CID 73212848) has the molecular formula C17H18BrFN2O and a molecular weight of 365.25 g/mol. Its IUPAC name is 4-bromo-N-(cyclobutylmethyl)-N-[(3-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(cyclobutylmethyl)-N-[(3-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 73212848 |
| Molecular Formula | C17H18BrFN2O |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4-bromo-N-(cyclobutylmethyl)-N-[(3-fluorophenyl)methyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(c1cc(Br)c[nH]1)N(Cc1cccc(F)c1)CC1CCC1 |
| InChI | InChI=1S/C17H18BrFN2O/c18-14-8-16(20-9-14)17(22)21(10-12-3-1-4-12)11-13-5-2-6-15(19)7-13/h2,5-9,12,20H,1,3-4,10-11H2 |
| InChIKey | JCCLBCZUAUAZBY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |