C16H19BrO4 — CID 73212953
5-[(1R,3S)-5-bromo-2-adamantylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 73212953) has the molecular formula C16H19BrO4 and a molecular weight of 355.23 g/mol. Its IUPAC name is 5-[(1R,3S)-5-bromo-2-adamantylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(1R,3S)-5-bromo-2-adamantylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 73212953 |
| Molecular Formula | C16H19BrO4 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 5-[(1R,3S)-5-bromo-2-adamantylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2[C@@H]3CC4C[C@H]2CC(Br)(C4)C3)C(=O)O1 |
| InChI | InChI=1S/C16H19BrO4/c1-15(2)20-13(18)12(14(19)21-15)11-9-3-8-4-10(11)7-16(17,5-8)6-9/h8-10H,3-7H2,1-2H3/t8?,9-,10+,16? |
| InChIKey | XBTGMUXRLWTZIQ-OYCDBOOFSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|