C12H24N2O4 — CID 73212977
N-[(3S,4R,5R,6S)-1-butyl-4,5,6-trihydroxyazepan-3-yl]acetamide (PubChem CID 73212977) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is N-[(3S,4R,5R,6S)-1-butyl-4,5,6-trihydroxyazepan-3-yl]acetamide.
| Compound Name | N-[(3S,4R,5R,6S)-1-butyl-4,5,6-trihydroxyazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 73212977 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N-[(3S,4R,5R,6S)-1-butyl-4,5,6-trihydroxyazepan-3-yl]acetamide |
| SMILES | CCCCN1C[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H24N2O4/c1-3-4-5-14-6-9(13-8(2)15)11(17)12(18)10(16)7-14/h9-12,16-18H,3-7H2,1-2H3,(H,13,15)/t9-,10-,11+,12+/m0/s1 |
| InChIKey | NAWGKYJJQFLIQM-NNYUYHANSA-N |
| XLogP | -1.31 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |