C36H62N2O6 — CID 73213793
6-[6-[4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]hexanoylamino]hexanoic acid (PubChem CID 73213793) has the molecular formula C36H62N2O6 and a molecular weight of 618.90 g/mol. Its IUPAC name is 6-[6-[4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]hexanoylamino]hexanoic acid.
| Compound Name | 6-[6-[4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]hexanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 73213793 |
| Molecular Formula | C36H62N2O6 |
| Molecular Weight | 618.90 g/mol |
| Exact Mass | 618.46 |
| IUPAC Name | 6-[6-[4-[(3R,7R,10S,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]hexanoylamino]hexanoic acid |
| SMILES | CC(CCC(=O)NCCCCCC(=O)NCCCCCC(=O)O)[C@H]1CCC2C3C(O)CC4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H62N2O6/c1-24(12-15-32(42)38-21-8-4-6-10-31(41)37-20-9-5-7-11-33(43)44)27-13-14-28-34-29(17-19-36(27,28)3)35(2)18-16-26(39)22-25(35)23-30(34)40/h24-30,34,39-40H,4-23H2,1-3H3,(H,37,41)(H,38,42)(H,43,44)/t24?,25?,26-,27-,28?,29?,30?,34?,35+,36-/m1/s1 |
| InChIKey | SOXGXMCIEIEDGX-PVHHMCNYSA-N |
| XLogP | 5.83 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.90 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|