C15H23N5O2S — CID 73213975
(3S,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-(2-methoxyethylsulfanylmethyl)pyrrolidin-3-ol (PubChem CID 73213975) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is (3S,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-(2-methoxyethylsulfanylmethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-(2-methoxyethylsulfanylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 73213975 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (3S,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-(2-methoxyethylsulfanylmethyl)pyrrolidin-3-ol |
| SMILES | COCCSC[C@H]1CN(Cc2c[nH]c3c(N)ncnc23)C[C@H]1O |
| InChI | InChI=1S/C15H23N5O2S/c1-22-2-3-23-8-11-6-20(7-12(11)21)5-10-4-17-14-13(10)18-9-19-15(14)16/h4,9,11-12,17,21H,2-3,5-8H2,1H3,(H2,16,18,19)/t11-,12-/m1/s1 |
| InChIKey | JCCMQBOBHRPZEK-VXGBXAGGSA-N |
| XLogP | 0.71 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|