C36H44F3N5O7S2 — CID 73215471
[4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] N-[2-(4-tert-butyl-1,3-thiazol-2-yl)-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 73215471) has the molecular formula C36H44F3N5O7S2 and a molecular weight of 779.90 g/mol. Its IUPAC name is [4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] N-[2-(4-tert-butyl-1,3-thiazol-2-yl)-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] N-[2-(4-tert-butyl-1,3-thiazol-2-yl)-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 73215471 |
| Molecular Formula | C36H44F3N5O7S2 |
| Molecular Weight | 779.90 g/mol |
| Exact Mass | 779.26 |
| IUPAC Name | [4-(cyclopropylsulfonylcarbamoyl)-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-en-17-yl] N-[2-(4-tert-butyl-1,3-thiazol-2-yl)-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | CN1CCCCC=CC2CC2(C(=O)NS(=O)(=O)C2CC2)NC(=O)C2CC(OC(=O)Nc3cc(C(F)(F)F)ccc3-c3nc(C(C)(C)C)cs3)CC2C1=O |
| InChI | InChI=1S/C36H44F3N5O7S2/c1-34(2,3)28-19-52-30(41-28)24-13-10-20(36(37,38)39)15-27(24)40-33(48)51-22-16-25-26(17-22)31(46)44(4)14-8-6-5-7-9-21-18-35(21,42-29(25)45)32(47)43-53(49,50)23-11-12-23/h7,9-10,13,15,19,21-23,25-26H,5-6,8,11-12,14,16-18H2,1-4H3,(H,40,48)(H,42,45)(H,43,47) |
| InChIKey | GVIOAHOFWZSSPS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 163.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|