About 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide
1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide (PubChem CID 73217660) has the molecular formula C18H22N4O5
and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide |
| PubChem CID | 73217660 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide |
| SMILES | COCCN1C(=O)N=C2C=C(C(=O)N3CCC(C(N)=O)CC3)C=CC2C1=O |
| InChI | InChI=1S/C18H22N4O5/c1-27-9-8-22-17(25)13-3-2-12(10-14(13)20-18(22)26)16(24)21-6-4-11(5-7-21)15(19)23/h2-3,10-11,13H,4-9H2,1H3,(H2,19,23) |
| InChIKey | JEZKSGGIHJBOGD-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide?
The IUPAC name of 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide (CID 73217660) is 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide is COCCN1C(=O)N=C2C=C(C(=O)N3CCC(C(N)=O)CC3)C=CC2C1=O.
What is the InChIKey of 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide?
The InChIKey is JEZKSGGIHJBOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O5/c1-27-9-8-22-17(25)13-3-2-12(10-14(13)20-18(22)26)16(24)21-6-4-11(5-7-21)15(19)23/h2-3,10-11,13H,4-9H2,1H3,(H2,19,23).
What are the key properties of 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide?
1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide has a molecular weight of 374.40 g/mol, XLogP of -0.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-methoxyethyl)-2,4-dioxo-4aH-quinazoline-7-carbonyl]piperidine-4-carboxamide is sourced from PubChem (CID 73217660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).