C27H19ClF3N5O2 — CID 73218668
7-(4-chlorophenyl)-8-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 73218668) has the molecular formula C27H19ClF3N5O2 and a molecular weight of 537.93 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-8-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 7-(4-chlorophenyl)-8-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 73218668 |
| Molecular Formula | C27H19ClF3N5O2 |
| Molecular Weight | 537.93 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 7-(4-chlorophenyl)-8-[4-(N-hydroxy-C-methylcarbonimidoyl)phenyl]-2-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CC(=NO)c1ccc(-c2c(-c3ccc(Cl)cc3)ccn3c(=O)n(Cc4ccc(C(F)(F)F)nc4)nc23)cc1 |
| InChI | InChI=1S/C27H19ClF3N5O2/c1-16(34-38)18-3-5-20(6-4-18)24-22(19-7-9-21(28)10-8-19)12-13-35-25(24)33-36(26(35)37)15-17-2-11-23(32-14-17)27(29,30)31/h2-14,38H,15H2,1H3 |
| InChIKey | SAHZLMSRINNFPS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.93 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|