C20H30N2O4 — CID 7321915
methyl (2R)-4-methyl-2-[[(3R)-3-methyl-5-(4-methylanilino)-5-oxopentanoyl]amino]pentanoate (PubChem CID 7321915) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl (2R)-4-methyl-2-[[(3R)-3-methyl-5-(4-methylanilino)-5-oxopentanoyl]amino]pentanoate.
| Compound Name | methyl (2R)-4-methyl-2-[[(3R)-3-methyl-5-(4-methylanilino)-5-oxopentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 7321915 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | methyl (2R)-4-methyl-2-[[(3R)-3-methyl-5-(4-methylanilino)-5-oxopentanoyl]amino]pentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)C[C@@H](C)CC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-13(2)10-17(20(25)26-5)22-19(24)12-15(4)11-18(23)21-16-8-6-14(3)7-9-16/h6-9,13,15,17H,10-12H2,1-5H3,(H,21,23)(H,22,24)/t15-,17+/m0/s1 |
| InChIKey | RUHYKGUYYJYWAC-DOTOQJQBSA-N |
| XLogP | 3.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |