C26H32N6O3 — CID 73219775
8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-3-methyl-7-[(4-methylphenyl)methyl]-4,5-dihydropurine-2,6-dione (PubChem CID 73219775) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-3-methyl-7-[(4-methylphenyl)methyl]-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-3-methyl-7-[(4-methylphenyl)methyl]-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73219775 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-3-methyl-7-[(4-methylphenyl)methyl]-4,5-dihydropurine-2,6-dione |
| SMILES | COc1ccc(N2CCN(CC3=NC4C(C(=O)NC(=O)N4C)N3Cc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H32N6O3/c1-18-4-6-19(7-5-18)16-32-22(27-24-23(32)25(33)28-26(34)29(24)2)17-30-12-14-31(15-13-30)20-8-10-21(35-3)11-9-20/h4-11,23-24H,12-17H2,1-3H3,(H,28,33,34) |
| InChIKey | FSRJNFMDZXSMFG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|