C19H23ClO5 — CID 7321978
ethyl (3R,4S)-4-[(2R)-1-(4-chlorophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate (PubChem CID 7321978) has the molecular formula C19H23ClO5 and a molecular weight of 366.84 g/mol. Its IUPAC name is ethyl (3R,4S)-4-[(2R)-1-(4-chlorophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3R,4S)-4-[(2R)-1-(4-chlorophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 7321978 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | ethyl (3R,4S)-4-[(2R)-1-(4-chlorophenyl)-1-oxobutan-2-yl]-5,5-dimethyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)OC(C)(C)[C@H]1[C@@H](CC)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClO5/c1-5-13(16(21)11-7-9-12(20)10-8-11)15-14(17(22)24-6-2)18(23)25-19(15,3)4/h7-10,13-15H,5-6H2,1-4H3/t13-,14-,15+/m1/s1 |
| InChIKey | GYONFYNYMALABL-KFWWJZLASA-N |
| XLogP | 3.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|