2-hydroxy-5-sulfobenzoic acid

C7H6O6S — CID 7322

IUPAC2-hydroxy-5-sulfobenzoic acid
SMILESO=C(O)c1cc(S(=O)(=O)O)ccc1O
InChIInChI=1S/C7H6O6S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3,8H,(H,9,10)(H,11,12,13)
InChIKeyYCPXWRQRBFJBPZ-UHFFFAOYSA-N
MW218.19 g/mol
LogP0.34
Rot. Bonds2

About 2-hydroxy-5-sulfobenzoic acid

2-hydroxy-5-sulfobenzoic acid (PubChem CID 7322) has the molecular formula C7H6O6S and a molecular weight of 218.19 g/mol. Its IUPAC name is 2-hydroxy-5-sulfobenzoic acid.

Molecular Properties

Compound Name2-hydroxy-5-sulfobenzoic acid
PubChem CID7322
Molecular FormulaC7H6O6S
Molecular Weight218.19 g/mol
Exact Mass217.99
IUPAC Name2-hydroxy-5-sulfobenzoic acid
SMILESO=C(O)c1cc(S(=O)(=O)O)ccc1O
InChIInChI=1S/C7H6O6S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3,8H,(H,9,10)(H,11,12,13)
InChIKeyYCPXWRQRBFJBPZ-UHFFFAOYSA-N
XLogP0.34
TPSA111.90 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.19
LogP ≤ 50.34
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-hydroxy-5-sulfobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-5-sulfobenzoic acid?
The IUPAC name of 2-hydroxy-5-sulfobenzoic acid (CID 7322) is 2-hydroxy-5-sulfobenzoic acid.
What is the SMILES notation for 2-hydroxy-5-sulfobenzoic acid?
The canonical SMILES for 2-hydroxy-5-sulfobenzoic acid is O=C(O)c1cc(S(=O)(=O)O)ccc1O.
What is the InChIKey of 2-hydroxy-5-sulfobenzoic acid?
The InChIKey is YCPXWRQRBFJBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O6S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3,8H,(H,9,10)(H,11,12,13).
What are the key properties of 2-hydroxy-5-sulfobenzoic acid?
2-hydroxy-5-sulfobenzoic acid has a molecular weight of 218.19 g/mol, XLogP of 0.34, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-5-sulfobenzoic acid is sourced from PubChem (CID 7322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).