C12H11NO5S — CID 7322278
methyl (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 7322278) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 7322278 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2ccco2)C1=O |
| InChI | InChI=1S/C12H11NO5S/c1-7(11(15)17-2)13-10(14)9(19-12(13)16)6-8-4-3-5-18-8/h3-7H,1-2H3/b9-6+/t7-/m1/s1 |
| InChIKey | XCLMIGPQTNLHDS-TUOMEMKJSA-N |
| XLogP | 1.88 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|