C15H22OSi — CID 73223206
3-benzyl-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole (PubChem CID 73223206) has the molecular formula C15H22OSi and a molecular weight of 246.43 g/mol. Its IUPAC name is 3-benzyl-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole.
| Compound Name | 3-benzyl-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole |
|---|---|
| PubChem CID | 73223206 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-benzyl-2,2-dimethyl-3,3a,4,5,6,6a-hexahydrocyclopenta[d]oxasilole |
| SMILES | C[Si]1(C)OC2CCCC2C1Cc1ccccc1 |
| InChI | InChI=1S/C15H22OSi/c1-17(2)15(11-12-7-4-3-5-8-12)13-9-6-10-14(13)16-17/h3-5,7-8,13-15H,6,9-11H2,1-2H3 |
| InChIKey | DPCNJYWITGVTPZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|