About 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine
5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 732250) has the molecular formula C10H8Cl2N2S
and a molecular weight of 259.16 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 732250 |
| Molecular Formula | C10H8Cl2N2S |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C10H8Cl2N2S/c11-7-2-1-6(9(12)4-7)3-8-5-14-10(13)15-8/h1-2,4-5H,3H2,(H2,13,14) |
| InChIKey | TXWHLSLBDQJHHF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine (CID 732250) is 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine is Nc1ncc(Cc2ccc(Cl)cc2Cl)s1.
What is the InChIKey of 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine?
The InChIKey is TXWHLSLBDQJHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N2S/c11-7-2-1-6(9(12)4-7)3-8-5-14-10(13)15-8/h1-2,4-5H,3H2,(H2,13,14).
What are the key properties of 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine?
5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine has a molecular weight of 259.16 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dichlorophenyl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 732250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).