C22H18N6O3 — CID 73225914
3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]-N-(pyrimidin-2-ylmethyl)furo[2,3-c]pyridine-2-carboxamide (PubChem CID 73225914) has the molecular formula C22H18N6O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is 3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]-N-(pyrimidin-2-ylmethyl)furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]-N-(pyrimidin-2-ylmethyl)furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 73225914 |
| Molecular Formula | C22H18N6O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[(1-hydroxyimino-2,3-dihydroinden-5-yl)amino]-N-(pyrimidin-2-ylmethyl)furo[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NCc1ncccn1)c1oc2cnccc2c1Nc1ccc2c(c1)CCC2=NO |
| InChI | InChI=1S/C22H18N6O3/c29-22(26-12-19-24-7-1-8-25-19)21-20(16-6-9-23-11-18(16)31-21)27-14-3-4-15-13(10-14)2-5-17(15)28-30/h1,3-4,6-11,27,30H,2,5,12H2,(H,26,29) |
| InChIKey | UBEHUTPIQLKBGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|