C23H16F3N3O2 — CID 73226083
N-[5-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 73226083) has the molecular formula C23H16F3N3O2 and a molecular weight of 423.39 g/mol. Its IUPAC name is N-[5-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 73226083 |
| Molecular Formula | C23H16F3N3O2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[5-[[2-[4-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-yl]amino]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | ON=C1CCc2cc(Nc3c(-c4ccc(C(F)(F)F)cc4)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C23H16F3N3O2/c24-23(25,26)15-4-1-13(2-5-15)22-21(18-9-10-27-12-20(18)31-22)28-16-6-7-17-14(11-16)3-8-19(17)29-30/h1-2,4-7,9-12,28,30H,3,8H2 |
| InChIKey | DHYMXTZYMQHAPF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|