C24H24ClF3N6O3 — CID 73226924
1-(3-chloro-2-pyridinyl)-N-[2-[C-(diethylcarbamoyl)-N-hydroxycarbonimidoyl]-4,6-dimethylphenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 73226924) has the molecular formula C24H24ClF3N6O3 and a molecular weight of 536.94 g/mol. Its IUPAC name is 1-(3-chloro-2-pyridinyl)-N-[2-[C-(diethylcarbamoyl)-N-hydroxycarbonimidoyl]-4,6-dimethylphenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-chloro-2-pyridinyl)-N-[2-[C-(diethylcarbamoyl)-N-hydroxycarbonimidoyl]-4,6-dimethylphenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 73226924 |
| Molecular Formula | C24H24ClF3N6O3 |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 1-(3-chloro-2-pyridinyl)-N-[2-[C-(diethylcarbamoyl)-N-hydroxycarbonimidoyl]-4,6-dimethylphenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)C(=NO)c1cc(C)cc(C)c1NC(=O)c1cc(C(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C24H24ClF3N6O3/c1-5-33(6-2)23(36)20(32-37)15-11-13(3)10-14(4)19(15)30-22(35)17-12-18(24(26,27)28)31-34(17)21-16(25)8-7-9-29-21/h7-12,37H,5-6H2,1-4H3,(H,30,35) |
| InChIKey | GPGVDKDXKKGVIA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|