C30H50O4 — CID 73227090
tert-butyl 6-(5-heptyl-2-oct-1-ynyl-4-oxocyclopent-2-en-1-yl)oxyhexanoate (PubChem CID 73227090) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is tert-butyl 6-(5-heptyl-2-oct-1-ynyl-4-oxocyclopent-2-en-1-yl)oxyhexanoate.
| Compound Name | tert-butyl 6-(5-heptyl-2-oct-1-ynyl-4-oxocyclopent-2-en-1-yl)oxyhexanoate |
|---|---|
| PubChem CID | 73227090 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | tert-butyl 6-(5-heptyl-2-oct-1-ynyl-4-oxocyclopent-2-en-1-yl)oxyhexanoate |
| SMILES | CCCCCCC#CC1=CC(=O)C(CCCCCCC)C1OCCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H50O4/c1-6-8-10-12-14-16-20-25-24-27(31)26(21-17-13-11-9-7-2)29(25)33-23-19-15-18-22-28(32)34-30(3,4)5/h24,26,29H,6-15,17-19,21-23H2,1-5H3 |
| InChIKey | IPLRCAZYGULWBD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|