C24H28FN7 — CID 73227962
4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-4-N-ethyl-5-fluoro-2-N-(3-pyridin-3-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 73227962) has the molecular formula C24H28FN7 and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-4-N-ethyl-5-fluoro-2-N-(3-pyridin-3-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-4-N-ethyl-5-fluoro-2-N-(3-pyridin-3-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 73227962 |
| Molecular Formula | C24H28FN7 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 4-N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-4-N-ethyl-5-fluoro-2-N-(3-pyridin-3-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCN(c1nc(Nc2cccc(-c3cccnc3)c2)ncc1F)C1CCCC2NNCC21 |
| InChI | InChI=1S/C24H28FN7/c1-2-32(22-10-4-9-21-19(22)14-28-31-21)23-20(25)15-27-24(30-23)29-18-8-3-6-16(12-18)17-7-5-11-26-13-17/h3,5-8,11-13,15,19,21-22,28,31H,2,4,9-10,14H2,1H3,(H,27,29,30) |
| InChIKey | IEIMRVPHXSOMLB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |