C32H46O12 — CID 73228153
(3a,4,9,10,11-pentaacetyloxy-2,5,8,8,12-pentamethyl-2,3,4,5,9,10,11,13a-octahydro-1H-cyclopenta[12]annulen-1-yl) acetate (PubChem CID 73228153) has the molecular formula C32H46O12 and a molecular weight of 622.71 g/mol. Its IUPAC name is (3a,4,9,10,11-pentaacetyloxy-2,5,8,8,12-pentamethyl-2,3,4,5,9,10,11,13a-octahydro-1H-cyclopenta[12]annulen-1-yl) acetate.
| Compound Name | (3a,4,9,10,11-pentaacetyloxy-2,5,8,8,12-pentamethyl-2,3,4,5,9,10,11,13a-octahydro-1H-cyclopenta[12]annulen-1-yl) acetate |
|---|---|
| PubChem CID | 73228153 |
| Molecular Formula | C32H46O12 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | (3a,4,9,10,11-pentaacetyloxy-2,5,8,8,12-pentamethyl-2,3,4,5,9,10,11,13a-octahydro-1H-cyclopenta[12]annulen-1-yl) acetate |
| SMILES | CC(=O)OC1C(C)=CC2C(OC(C)=O)C(C)CC2(OC(C)=O)C(OC(C)=O)C(C)C=CC(C)(C)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H46O12/c1-16-12-13-31(10,11)30(43-23(8)37)28(41-21(6)35)27(40-20(5)34)17(2)14-25-26(39-19(4)33)18(3)15-32(25,44-24(9)38)29(16)42-22(7)36/h12-14,16,18,25-30H,15H2,1-11H3 |
| InChIKey | VZVWCXPXOSVWOB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|