C40H50 — CID 73229405
1,5,5-trimethyl-6-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexa-2,4-dien-1-ylidene)octadeca-2,4,6,8,10,12,14,16-octaenylidene]cyclohexa-1,3-diene (PubChem CID 73229405) has the molecular formula C40H50 and a molecular weight of 530.84 g/mol. Its IUPAC name is 1,5,5-trimethyl-6-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexa-2,4-dien-1-ylidene)octadeca-2,4,6,8,10,12,14,16-octaenylidene]cyclohexa-1,3-diene.
| Compound Name | 1,5,5-trimethyl-6-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexa-2,4-dien-1-ylidene)octadeca-2,4,6,8,10,12,14,16-octaenylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 73229405 |
| Molecular Formula | C40H50 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | 1,5,5-trimethyl-6-[3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexa-2,4-dien-1-ylidene)octadeca-2,4,6,8,10,12,14,16-octaenylidene]cyclohexa-1,3-diene |
| SMILES | CC(C=CC=CC(C)=CC=CC(C)=CC=C1C(C)=CC=CC1(C)C)=CC=CC(C)=CC=C1C(C)=CC=CC1(C)C |
| InChI | InChI=1S/C40H50/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-30H,1-10H3 |
| InChIKey | PWZXLDMNUZDPKS-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|