About [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea
[(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 73229546) has the molecular formula C10H10BrN3O2S2
and a molecular weight of 348.25 g/mol. Its IUPAC name is [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| PubChem CID | 73229546 |
| Molecular Formula | C10H10BrN3O2S2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | NC(=S)NN=C1CCS(=O)(=O)c2ccc(Br)cc21 |
| InChI | InChI=1S/C10H10BrN3O2S2/c11-6-1-2-9-7(5-6)8(13-14-10(12)17)3-4-18(9,15)16/h1-2,5H,3-4H2,(H3,12,14,17) |
| InChIKey | XOBXSIZLGQEDSF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The IUPAC name of [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (CID 73229546) is [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
What is the SMILES notation for [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The canonical SMILES for [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is NC(=S)NN=C1CCS(=O)(=O)c2ccc(Br)cc21.
What is the InChIKey of [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
The InChIKey is XOBXSIZLGQEDSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN3O2S2/c11-6-1-2-9-7(5-6)8(13-14-10(12)17)3-4-18(9,15)16/h1-2,5H,3-4H2,(H3,12,14,17).
What are the key properties of [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea?
[(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea has a molecular weight of 348.25 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6-bromo-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]thiourea is sourced from PubChem (CID 73229546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).