C15H27N — CID 73229805
8-butyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 73229805) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 8-butyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 8-butyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 73229805 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 8-butyl-5-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C=CCC1CCC(CCCC)C2CCCN12 |
| InChI | InChI=1S/C15H27N/c1-3-5-8-13-10-11-14(7-4-2)16-12-6-9-15(13)16/h4,13-15H,2-3,5-12H2,1H3 |
| InChIKey | NGXFGKMXEDDWAN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|