About 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile
9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (PubChem CID 73230794) has the molecular formula C16H9N5O
and a molecular weight of 287.28 g/mol. Its IUPAC name is 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| PubChem CID | 73230794 |
| Molecular Formula | C16H9N5O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile |
| SMILES | C=CCON=C1c2ccccc2-c2nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C16H9N5O/c1-2-7-22-21-15-11-6-4-3-5-10(11)14-16(15)20-13(9-18)12(8-17)19-14/h2-6H,1,7H2 |
| InChIKey | XLOXSIKLUAMDGU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The IUPAC name of 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile (CID 73230794) is 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The canonical SMILES for 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile is C=CCON=C1c2ccccc2-c2nc(C#N)c(C#N)nc21.
What is the InChIKey of 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
The InChIKey is XLOXSIKLUAMDGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N5O/c1-2-7-22-21-15-11-6-4-3-5-10(11)14-16(15)20-13(9-18)12(8-17)19-14/h2-6H,1,7H2.
What are the key properties of 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile?
9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile has a molecular weight of 287.28 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-prop-2-enoxyiminoindeno[1,2-b]pyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 73230794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).