C22H22ClN3O2 — CID 73231601
methyl 2-[6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate (PubChem CID 73231601) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is methyl 2-[6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 73231601 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | methyl 2-[6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N1CCN2C(C#Cc3cccc(Cl)c3)CCC2C1 |
| InChI | InChI=1S/C22H22ClN3O2/c1-28-22(27)20-6-3-11-24-21(20)25-12-13-26-18(9-10-19(26)15-25)8-7-16-4-2-5-17(23)14-16/h2-6,11,14,18-19H,9-10,12-13,15H2,1H3 |
| InChIKey | KANAMSROTJGUJX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|