C8H9F3O3 — CID 7323297
methyl (6S)-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate (PubChem CID 7323297) has the molecular formula C8H9F3O3 and a molecular weight of 210.15 g/mol. Its IUPAC name is methyl (6S)-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate.
| Compound Name | methyl (6S)-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 7323297 |
| Molecular Formula | C8H9F3O3 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | methyl (6S)-6-(trifluoromethyl)-2,5-dihydropyran-6-carboxylate |
| SMILES | COC(=O)[C@]1(C(F)(F)F)CC=CCO1 |
| InChI | InChI=1S/C8H9F3O3/c1-13-6(12)7(8(9,10)11)4-2-3-5-14-7/h2-3H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | PWRVOHRDESZIIS-ZETCQYMHSA-N |
| XLogP | 1.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|