C23H27NO — CID 7323694
(E)-N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(E)-3-phenylprop-2-enyl]prop-2-en-1-amine (PubChem CID 7323694) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (E)-N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(E)-3-phenylprop-2-enyl]prop-2-en-1-amine.
| Compound Name | (E)-N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(E)-3-phenylprop-2-enyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 7323694 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (E)-N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(E)-3-phenylprop-2-enyl]prop-2-en-1-amine |
| SMILES | C(=C/c1ccccc1)\CN(C/C=C/c1ccccc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H27NO/c1-3-10-21(11-4-1)14-7-17-24(20-23-16-9-19-25-23)18-8-15-22-12-5-2-6-13-22/h1-8,10-15,23H,9,16-20H2/b14-7+,15-8+/t23-/m1/s1 |
| InChIKey | CKKCAEVOVWDVFC-IJVSWKGXSA-N |
| XLogP | 4.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |