C19H32N3O4+ — CID 7323847
3-[[2-(2,5-dimethoxyanilino)-2-oxoacetyl]amino]propyl-dipropylazanium (PubChem CID 7323847) has the molecular formula C19H32N3O4+ and a molecular weight of 366.48 g/mol. Its IUPAC name is 3-[[2-(2,5-dimethoxyanilino)-2-oxoacetyl]amino]propyl-dipropylazanium.
| Compound Name | 3-[[2-(2,5-dimethoxyanilino)-2-oxoacetyl]amino]propyl-dipropylazanium |
|---|---|
| PubChem CID | 7323847 |
| Molecular Formula | C19H32N3O4+ |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 3-[[2-(2,5-dimethoxyanilino)-2-oxoacetyl]amino]propyl-dipropylazanium |
| SMILES | CCC[NH+](CCC)CCCNC(=O)C(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H31N3O4/c1-5-11-22(12-6-2)13-7-10-20-18(23)19(24)21-16-14-15(25-3)8-9-17(16)26-4/h8-9,14H,5-7,10-13H2,1-4H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | AKFWKNKTXQSIDD-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|