C20H24ClN3O2S2 — CID 73242683
3-thiophen-2-yl-N-[2-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]ethyl]prop-2-enamide;hydrochloride (PubChem CID 73242683) has the molecular formula C20H24ClN3O2S2 and a molecular weight of 438.02 g/mol. Its IUPAC name is 3-thiophen-2-yl-N-[2-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]ethyl]prop-2-enamide;hydrochloride.
| Compound Name | 3-thiophen-2-yl-N-[2-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]ethyl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 73242683 |
| Molecular Formula | C20H24ClN3O2S2 |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 3-thiophen-2-yl-N-[2-[4-(3-thiophen-2-ylprop-2-enoyl)piperazin-1-yl]ethyl]prop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1cccs1)NCCN1CCN(C(=O)C=Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H23N3O2S2.ClH/c24-19(7-5-17-3-1-15-26-17)21-9-10-22-11-13-23(14-12-22)20(25)8-6-18-4-2-16-27-18;/h1-8,15-16H,9-14H2,(H,21,24);1H |
| InChIKey | WMWWUZIBWCMFSO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|