C11H20N3O5P — CID 73242891
1-(5-methylfuran-2-yl)-N-(4-methylpiperazin-1-yl)methanimine;phosphoric acid (PubChem CID 73242891) has the molecular formula C11H20N3O5P and a molecular weight of 305.27 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-N-(4-methylpiperazin-1-yl)methanimine;phosphoric acid.
| Compound Name | 1-(5-methylfuran-2-yl)-N-(4-methylpiperazin-1-yl)methanimine;phosphoric acid |
|---|---|
| PubChem CID | 73242891 |
| Molecular Formula | C11H20N3O5P |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-N-(4-methylpiperazin-1-yl)methanimine;phosphoric acid |
| SMILES | Cc1ccc(C=NN2CCN(C)CC2)o1.O=P(O)(O)O |
| InChI | InChI=1S/C11H17N3O.H3O4P/c1-10-3-4-11(15-10)9-12-14-7-5-13(2)6-8-14;1-5(2,3)4/h3-4,9H,5-8H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | WZYLMQKLHOVSPB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|