C14H10N8 — CID 732431
2,5-diphenyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)tetrazol-3-ium (PubChem CID 732431) has the molecular formula C14H10N8 and a molecular weight of 290.29 g/mol. Its IUPAC name is 2,5-diphenyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)tetrazol-3-ium.
| Compound Name | 2,5-diphenyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)tetrazol-3-ium |
|---|---|
| PubChem CID | 732431 |
| Molecular Formula | C14H10N8 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2,5-diphenyl-3-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)tetrazol-3-ium |
| SMILES | c1ccc(-c2nn(-c3ccccc3)[n+](-c3nnn[n-]3)n2)cc1 |
| InChI | InChI=1S/C14H10N8/c1-3-7-11(8-4-1)13-17-21(12-9-5-2-6-10-12)22(18-13)14-15-19-20-16-14/h1-10H |
| InChIKey | TYQMURMXSIMFSS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 87.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|