About propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride
propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride (PubChem CID 73243186) has the molecular formula C22H25ClN2O2
and a molecular weight of 384.91 g/mol. Its IUPAC name is propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride.
Molecular Properties
| Compound Name | propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride |
| PubChem CID | 73243186 |
| Molecular Formula | C22H25ClN2O2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride |
| SMILES | CCCOC(=O)Nc1ccccc1/N=C1\CCCC1=Cc1ccccc1.Cl |
| InChI | InChI=1S/C22H24N2O2.ClH/c1-2-15-26-22(25)24-21-13-7-6-12-20(21)23-19-14-8-11-18(19)16-17-9-4-3-5-10-17;/h3-7,9-10,12-13,16H,2,8,11,14-15H2,1H3,(H,24,25);1H/b18-16?,23-19+; |
| InChIKey | ZAFVXIHORFEIND-MZJIFTAOSA-N |
| XLogP | 6.41 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride?
The IUPAC name of propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride (CID 73243186) is propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride.
What is the SMILES notation for propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride?
The canonical SMILES for propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride is CCCOC(=O)Nc1ccccc1/N=C1\CCCC1=Cc1ccccc1.Cl.
What is the InChIKey of propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride?
The InChIKey is ZAFVXIHORFEIND-MZJIFTAOSA-N. The full InChI is InChI=1S/C22H24N2O2.ClH/c1-2-15-26-22(25)24-21-13-7-6-12-20(21)23-19-14-8-11-18(19)16-17-9-4-3-5-10-17;/h3-7,9-10,12-13,16H,2,8,11,14-15H2,1H3,(H,24,25);1H/b18-16?,23-19+;.
What are the key properties of propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride?
propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride has a molecular weight of 384.91 g/mol, XLogP of 6.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-[2-[(2-benzylidenecyclopentylidene)amino]phenyl]carbamate;hydrochloride is sourced from PubChem (CID 73243186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).