C21H19FN2O6 — CID 7325161
(2R)-2-[4-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 7325161) has the molecular formula C21H19FN2O6 and a molecular weight of 414.39 g/mol. Its IUPAC name is (2R)-2-[4-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 7325161 |
| Molecular Formula | C21H19FN2O6 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (2R)-2-[4-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2\NC(=O)N(Cc3ccc(F)cc3)C2=O)ccc1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C21H19FN2O6/c1-12(20(26)27)30-17-8-5-14(10-18(17)29-2)9-16-19(25)24(21(28)23-16)11-13-3-6-15(22)7-4-13/h3-10,12H,11H2,1-2H3,(H,23,28)(H,26,27)/b16-9-/t12-/m1/s1 |
| InChIKey | JMWVSLIFJDMESY-DZZSIBQASA-N |
| XLogP | 2.78 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|