About 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid
3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid (PubChem CID 73254847) has the molecular formula C27H25ClO2
and a molecular weight of 416.95 g/mol. Its IUPAC name is 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid.
Molecular Properties
| Compound Name | 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid |
| PubChem CID | 73254847 |
| Molecular Formula | C27H25ClO2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid |
| SMILES | CC1(C)CC=C(c2ccccc2)c2cc(CCc3ccc(C(=O)O)cc3Cl)ccc21 |
| InChI | InChI=1S/C27H25ClO2/c1-27(2)15-14-22(19-6-4-3-5-7-19)23-16-18(9-13-24(23)27)8-10-20-11-12-21(26(29)30)17-25(20)28/h3-7,9,11-14,16-17H,8,10,15H2,1-2H3,(H,29,30) |
| InChIKey | LHFXMNSXQMAKBX-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid?
The IUPAC name of 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid (CID 73254847) is 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid.
What is the SMILES notation for 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid?
The canonical SMILES for 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid is CC1(C)CC=C(c2ccccc2)c2cc(CCc3ccc(C(=O)O)cc3Cl)ccc21.
What is the InChIKey of 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid?
The InChIKey is LHFXMNSXQMAKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25ClO2/c1-27(2)15-14-22(19-6-4-3-5-7-19)23-16-18(9-13-24(23)27)8-10-20-11-12-21(26(29)30)17-25(20)28/h3-7,9,11-14,16-17H,8,10,15H2,1-2H3,(H,29,30).
What are the key properties of 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid?
3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid has a molecular weight of 416.95 g/mol, XLogP of 6.94, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[2-(5,5-dimethyl-8-phenyl-6H-naphthalen-2-yl)ethyl]benzoic acid is sourced from PubChem (CID 73254847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).