C15H22NO5P — CID 73257880
[2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]phenyl]phosphonic acid (PubChem CID 73257880) has the molecular formula C15H22NO5P and a molecular weight of 327.32 g/mol. Its IUPAC name is [2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]phenyl]phosphonic acid.
| Compound Name | [2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 73257880 |
| Molecular Formula | C15H22NO5P |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethoxy]phenyl]phosphonic acid |
| SMILES | CC1CC(C)CN(C(=O)COc2ccccc2P(=O)(O)O)C1 |
| InChI | InChI=1S/C15H22NO5P/c1-11-7-12(2)9-16(8-11)15(17)10-21-13-5-3-4-6-14(13)22(18,19)20/h3-6,11-12H,7-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | CWHGMAAFLXIZPZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|