C26H28ClNO6 — CID 73258607
9-(5-chloro-2,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73258607) has the molecular formula C26H28ClNO6 and a molecular weight of 485.96 g/mol. Its IUPAC name is 9-(5-chloro-2,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 9-(5-chloro-2,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73258607 |
| Molecular Formula | C26H28ClNO6 |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 9-(5-chloro-2,4-dimethoxyphenyl)-3-(4-methoxyphenyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccc(C2=COC3C(CCC4OCN(c5cc(Cl)c(OC)cc5OC)CC43)C2=O)cc1 |
| InChI | InChI=1S/C26H28ClNO6/c1-30-16-6-4-15(5-7-16)19-13-33-26-17(25(19)29)8-9-22-18(26)12-28(14-34-22)21-10-20(27)23(31-2)11-24(21)32-3/h4-7,10-11,13,17-18,22,26H,8-9,12,14H2,1-3H3 |
| InChIKey | KSTXWHHHRAPRND-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|