C12H17N7O3 — CID 73258877
2-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)acetohydrazide (PubChem CID 73258877) has the molecular formula C12H17N7O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)acetohydrazide.
| Compound Name | 2-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)acetohydrazide |
|---|---|
| PubChem CID | 73258877 |
| Molecular Formula | C12H17N7O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)acetohydrazide |
| SMILES | CC1=C(C)N2C(=NC3C2C(=O)NC(=O)N3C)N1CC(=O)NN |
| InChI | InChI=1S/C12H17N7O3/c1-5-6(2)19-8-9(17(3)12(22)15-10(8)21)14-11(19)18(5)4-7(20)16-13/h8-9H,4,13H2,1-3H3,(H,16,20)(H,15,21,22) |
| InChIKey | ZUGXIHFBIBMHTH-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|