C23H30ClNO4 — CID 73259515
3-(4-chlorophenyl)-7-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 73259515) has the molecular formula C23H30ClNO4 and a molecular weight of 419.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(4-chlorophenyl)-7-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 73259515 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 3-(4-chlorophenyl)-7-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | CC1CN(CCOC2CCC3C(=O)C(c4ccc(Cl)cc4)=COC3C2)CC(C)O1 |
| InChI | InChI=1S/C23H30ClNO4/c1-15-12-25(13-16(2)29-15)9-10-27-19-7-8-20-22(11-19)28-14-21(23(20)26)17-3-5-18(24)6-4-17/h3-6,14-16,19-20,22H,7-13H2,1-2H3 |
| InChIKey | CKTUYEGNZDASDB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |