C19H29N7O3 — CID 73259524
1-[3-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)propyl]piperidine-4-carboxamide (PubChem CID 73259524) has the molecular formula C19H29N7O3 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[3-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 73259524 |
| Molecular Formula | C19H29N7O3 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 1-[3-(4,7,8-trimethyl-1,3-dioxo-4a,9a-dihydropurino[7,8-a]imidazol-6-yl)propyl]piperidine-4-carboxamide |
| SMILES | CC1=C(C)N2C(=NC3C2C(=O)NC(=O)N3C)N1CCCN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H29N7O3/c1-11-12(2)26-14-16(23(3)19(29)22-17(14)28)21-18(26)25(11)8-4-7-24-9-5-13(6-10-24)15(20)27/h13-14,16H,4-10H2,1-3H3,(H2,20,27)(H,22,28,29) |
| InChIKey | RMHORPWOBXIGTE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |