C25H29NO5S — CID 73259664
3-(3,4-dimethoxyphenyl)-9-(2-thiophen-2-ylethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one (PubChem CID 73259664) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-9-(2-thiophen-2-ylethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-9-(2-thiophen-2-ylethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 73259664 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-9-(2-thiophen-2-ylethyl)-4a,5,6,6a,8,10,10a,10b-octahydrochromeno[8,7-e][1,3]oxazin-4-one |
| SMILES | COc1ccc(C2=COC3C(CCC4OCN(CCc5cccs5)CC43)C2=O)cc1OC |
| InChI | InChI=1S/C25H29NO5S/c1-28-22-7-5-16(12-23(22)29-2)20-14-30-25-18(24(20)27)6-8-21-19(25)13-26(15-31-21)10-9-17-4-3-11-32-17/h3-5,7,11-12,14,18-19,21,25H,6,8-10,13,15H2,1-2H3 |
| InChIKey | IHKOYXKQTXZXDN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |