C18H14N4O5S — CID 73262756
methyl 2-[2-[(4-nitrophenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 73262756) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is methyl 2-[2-[(4-nitrophenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl 2-[2-[(4-nitrophenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 73262756 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | methyl 2-[2-[(4-nitrophenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)C=C1SC(=NNc2ccc([N+](=O)[O-])cc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H14N4O5S/c1-27-16(23)11-15-17(24)21(13-5-3-2-4-6-13)18(28-15)20-19-12-7-9-14(10-8-12)22(25)26/h2-11,19H,1H3 |
| InChIKey | GZPXMJTYLCPFTI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|