About 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide
1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide (PubChem CID 73263084) has the molecular formula C18H22BrN4O4+
and a molecular weight of 438.30 g/mol. Its IUPAC name is 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide |
| PubChem CID | 73263084 |
| Molecular Formula | C18H22BrN4O4+ |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide |
| SMILES | CCN1C(=O)C2C=C(Br)C=CC2=[N+](CC(=O)N2CCC(C(N)=O)CC2)C1=O |
| InChI | InChI=1S/C18H21BrN4O4/c1-2-22-17(26)13-9-12(19)3-4-14(13)23(18(22)27)10-15(24)21-7-5-11(6-8-21)16(20)25/h3-4,9,11,13H,2,5-8,10H2,1H3,(H-,20,25)/p+1 |
| InChIKey | ZRVYVZWCMBOSJW-UHFFFAOYSA-O |
| XLogP | 0.61 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide?
The IUPAC name of 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide (CID 73263084) is 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide is CCN1C(=O)C2C=C(Br)C=CC2=[N+](CC(=O)N2CCC(C(N)=O)CC2)C1=O.
What is the InChIKey of 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide?
The InChIKey is ZRVYVZWCMBOSJW-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H21BrN4O4/c1-2-22-17(26)13-9-12(19)3-4-14(13)23(18(22)27)10-15(24)21-7-5-11(6-8-21)16(20)25/h3-4,9,11,13H,2,5-8,10H2,1H3,(H-,20,25)/p+1.
What are the key properties of 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide?
1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide has a molecular weight of 438.30 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6-bromo-3-ethyl-2,4-dioxo-4aH-quinazolin-1-ium-1-yl)acetyl]piperidine-4-carboxamide is sourced from PubChem (CID 73263084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).