About 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide
4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide (PubChem CID 73265205) has the molecular formula C25H27ClN2O
and a molecular weight of 406.96 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide |
| PubChem CID | 73265205 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide |
| SMILES | CC(N[C@H]1CCCC[C@H]1NC(=O)c1ccc(Cl)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H27ClN2O/c1-17(21-10-6-8-18-7-2-3-9-22(18)21)27-23-11-4-5-12-24(23)28-25(29)19-13-15-20(26)16-14-19/h2-3,6-10,13-17,23-24,27H,4-5,11-12H2,1H3,(H,28,29)/t17?,23-,24+/m0/s1 |
| InChIKey | YTFUQWWKTIWYEY-FDPJYKKHSA-N |
| XLogP | 5.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide?
The IUPAC name of 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide (CID 73265205) is 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide.
What is the SMILES notation for 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide?
The canonical SMILES for 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide is CC(N[C@H]1CCCC[C@H]1NC(=O)c1ccc(Cl)cc1)c1cccc2ccccc12.
What is the InChIKey of 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide?
The InChIKey is YTFUQWWKTIWYEY-FDPJYKKHSA-N. The full InChI is InChI=1S/C25H27ClN2O/c1-17(21-10-6-8-18-7-2-3-9-22(18)21)27-23-11-4-5-12-24(23)28-25(29)19-13-15-20(26)16-14-19/h2-3,6-10,13-17,23-24,27H,4-5,11-12H2,1H3,(H,28,29)/t17?,23-,24+/m0/s1.
What are the key properties of 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide?
4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide has a molecular weight of 406.96 g/mol, XLogP of 5.89, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(1R,2S)-2-(1-naphthalen-1-ylethylamino)cyclohexyl]benzamide is sourced from PubChem (CID 73265205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).