C23H32Cl2N6O3 — CID 73265276
3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(diethylamino)butylamino]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 73265276) has the molecular formula C23H32Cl2N6O3 and a molecular weight of 511.45 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(diethylamino)butylamino]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(diethylamino)butylamino]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 73265276 |
| Molecular Formula | C23H32Cl2N6O3 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-7-[4-(diethylamino)butylamino]-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | CCN(CC)CCCCNc1ncc2c(n1)N(C)C(=O)N(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C23H32Cl2N6O3/c1-6-30(7-2)11-9-8-10-26-22-27-13-15-14-31(23(32)29(3)21(15)28-22)20-18(24)16(33-4)12-17(34-5)19(20)25/h12-13H,6-11,14H2,1-5H3,(H,26,27,28) |
| InChIKey | NHOUHWHGHAFDOP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|