C19H24NO3- — CID 73265296
(2S)-4-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate (PubChem CID 73265296) has the molecular formula C19H24NO3- and a molecular weight of 314.40 g/mol. Its IUPAC name is (2S)-4-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate.
| Compound Name | (2S)-4-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
|---|---|
| PubChem CID | 73265296 |
| Molecular Formula | C19H24NO3- |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (2S)-4-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
| SMILES | O=C([O-])[C@H](CC(=O)N1C[C@@H]2CCCC[C@H]2C1)Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c21-18(20-12-15-8-4-5-9-16(15)13-20)11-17(19(22)23)10-14-6-2-1-3-7-14/h1-3,6-7,15-17H,4-5,8-13H2,(H,22,23)/p-1/t15-,16-,17-/m0/s1 |
| InChIKey | WPGGHFDDFPHPOB-ULQDDVLXSA-M |
| XLogP | 1.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |