C46H49N7O6S — CID 73265321
CID 73265321 (PubChem CID 73265321) has the molecular formula C46H49N7O6S and a molecular weight of 828.01 g/mol.
| Compound Name | CID 73265321 |
|---|---|
| PubChem CID | 73265321 |
| Molecular Formula | C46H49N7O6S |
| Molecular Weight | 828.01 g/mol |
| Exact Mass | 827.35 |
| IUPAC Name | — |
| SMILES | Cc1c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)n(Cc4cccnc4)c23)c(COc2ccc(N3CCN([S+](=O)([O-])N(C)C)CC3)cc2)nn1C |
| InChI | InChI=1S/C46H49N7O6S/c1-32-43(41(48-50(32)4)31-59-36-21-19-35(20-22-36)51-24-26-52(27-25-51)60(56,57)49(2)3)40-16-8-15-38-39(17-10-28-58-42-18-7-13-34-12-5-6-14-37(34)42)45(46(54)55)53(44(38)40)30-33-11-9-23-47-29-33/h5-9,11-16,18-23,29H,10,17,24-28,30-31H2,1-4H3,(H-,54,55,56,57) |
| InChIKey | CNMHULGZUHYIAQ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.01 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|