About CID 73265321
CID 73265321 (PubChem CID 73265321) has the molecular formula C46H49N7O6S
and a molecular weight of 828.01 g/mol.
Molecular Properties
| Compound Name | CID 73265321 |
| PubChem CID | 73265321 |
| Molecular Formula | C46H49N7O6S |
| Molecular Weight | 828.01 g/mol |
| Exact Mass | 827.35 |
| IUPAC Name | — |
| SMILES | Cc1c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)n(Cc4cccnc4)c23)c(COc2ccc(N3CCN([S+](=O)([O-])N(C)C)CC3)cc2)nn1C |
| InChI | InChI=1S/C46H49N7O6S/c1-32-43(41(48-50(32)4)31-59-36-21-19-35(20-22-36)51-24-26-52(27-25-51)60(56,57)49(2)3)40-16-8-15-38-39(17-10-28-58-42-18-7-13-34-12-5-6-14-37(34)42)45(46(54)55)53(44(38)40)30-33-11-9-23-47-29-33/h5-9,11-16,18-23,29H,10,17,24-28,30-31H2,1-4H3,(H-,54,55,56,57) |
| InChIKey | CNMHULGZUHYIAQ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 828.01 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 73265321 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73265321?
The IUPAC name of CID 73265321 (CID 73265321) is not available.
What is the SMILES notation for CID 73265321?
The canonical SMILES for CID 73265321 is Cc1c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)n(Cc4cccnc4)c23)c(COc2ccc(N3CCN([S+](=O)([O-])N(C)C)CC3)cc2)nn1C.
What is the InChIKey of CID 73265321?
The InChIKey is CNMHULGZUHYIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H49N7O6S/c1-32-43(41(48-50(32)4)31-59-36-21-19-35(20-22-36)51-24-26-52(27-25-51)60(56,57)49(2)3)40-16-8-15-38-39(17-10-28-58-42-18-7-13-34-12-5-6-14-37(34)42)45(46(54)55)53(44(38)40)30-33-11-9-23-47-29-33/h5-9,11-16,18-23,29H,10,17,24-28,30-31H2,1-4H3,(H-,54,55,56,57).
What are the key properties of CID 73265321?
CID 73265321 has a molecular weight of 828.01 g/mol, XLogP of 7.38, 15 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73265321 is sourced from PubChem (CID 73265321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).