C19H30O3 — CID 73265343
(1S,3aS,3bR,5aS,9aS,9bR,11aS)-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromen-7-one (PubChem CID 73265343) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1S,3aS,3bR,5aS,9aS,9bR,11aS)-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromen-7-one.
| Compound Name | (1S,3aS,3bR,5aS,9aS,9bR,11aS)-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromen-7-one |
|---|---|
| PubChem CID | 73265343 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1S,3aS,3bR,5aS,9aS,9bR,11aS)-1-hydroxy-1,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,6,9,9b,10,11-dodecahydroindeno[4,5-h]isochromen-7-one |
| SMILES | C[C@]12COC(=O)C[C@@H]1CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C19H30O3/c1-17-11-22-16(20)10-12(17)4-5-13-14(17)6-8-18(2)15(13)7-9-19(18,3)21/h12-15,21H,4-11H2,1-3H3/t12-,13+,14+,15-,17-,18-,19-/m0/s1 |
| InChIKey | QSLJIVKCVHQPLV-RSBKEUSASA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |